C12H24F3IN4O — CID 109474238
3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-N,2,2-trimethylpropanamide;hydroiodide (PubChem CID 109474238) has the molecular formula C12H24F3IN4O and a molecular weight of 424.25 g/mol. Its IUPAC name is 3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-N,2,2-trimethylpropanamide;hydroiodide.
| Compound Name | 3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-N,2,2-trimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 109474238 |
| Molecular Formula | C12H24F3IN4O |
| Molecular Weight | 424.25 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-N,2,2-trimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)C(=O)NC)NCCC(F)(F)F.I |
| InChI | InChI=1S/C12H23F3N4O.HI/c1-5-17-10(18-7-6-12(13,14)15)19-8-11(2,3)9(20)16-4;/h5-8H2,1-4H3,(H,16,20)(H2,17,18,19);1H |
| InChIKey | NMAZUYNMOXVZHW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|