C12H23F3N4O — CID 109474239
3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-N,2,2-trimethylpropanamide (PubChem CID 109474239) has the molecular formula C12H23F3N4O and a molecular weight of 296.34 g/mol. Its IUPAC name is 3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 109474239 |
| Molecular Formula | C12H23F3N4O |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-N,2,2-trimethylpropanamide |
| SMILES | CCN/C(=N\CC(C)(C)C(=O)NC)NCCC(F)(F)F |
| InChI | InChI=1S/C12H23F3N4O/c1-5-17-10(18-7-6-12(13,14)15)19-8-11(2,3)9(20)16-4/h5-8H2,1-4H3,(H,16,20)(H2,17,18,19) |
| InChIKey | FEWDZEJKEZSMDQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|