C13H25F3N4O — CID 109474243
N-ethyl-3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-2,2-dimethylpropanamide (PubChem CID 109474243) has the molecular formula C13H25F3N4O and a molecular weight of 310.36 g/mol. Its IUPAC name is N-ethyl-3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-2,2-dimethylpropanamide.
| Compound Name | N-ethyl-3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 109474243 |
| Molecular Formula | C13H25F3N4O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | N-ethyl-3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-2,2-dimethylpropanamide |
| SMILES | CCNC(=O)C(C)(C)C/N=C(\NCC)NCCC(F)(F)F |
| InChI | InChI=1S/C13H25F3N4O/c1-5-17-10(21)12(3,4)9-20-11(18-6-2)19-8-7-13(14,15)16/h5-9H2,1-4H3,(H,17,21)(H2,18,19,20) |
| InChIKey | RUEYVJLBWDNFHK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|