C19H37IN4O — CID 109483298
N-cyclohexyl-3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]propanamide;hydroiodide (PubChem CID 109483298) has the molecular formula C19H37IN4O and a molecular weight of 464.44 g/mol. Its IUPAC name is N-cyclohexyl-3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]propanamide;hydroiodide.
| Compound Name | N-cyclohexyl-3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 109483298 |
| Molecular Formula | C19H37IN4O |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | N-cyclohexyl-3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]propanamide;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCCC(=O)NC1CCCCC1.I |
| InChI | InChI=1S/C19H36N4O.HI/c1-4-5-6-7-11-16-23(3)19(20-2)21-15-14-18(24)22-17-12-9-8-10-13-17;/h4,17H,1,5-16H2,2-3H3,(H,20,21)(H,22,24);1H |
| InChIKey | NYDVLNSZDWBBRS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|