C23H35IN6O — CID 109483302
N-[3-[[[ethylamino-[hept-6-enyl(methyl)amino]methylidene]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide;hydroiodide (PubChem CID 109483302) has the molecular formula C23H35IN6O and a molecular weight of 538.48 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[hept-6-enyl(methyl)amino]methylidene]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-[hept-6-enyl(methyl)amino]methylidene]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide;hydroiodide |
|---|---|
| PubChem CID | 109483302 |
| Molecular Formula | C23H35IN6O |
| Molecular Weight | 538.48 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | N-[3-[[[ethylamino-[hept-6-enyl(methyl)amino]methylidene]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N/Cc1cccc(NC(=O)Cn2cccn2)c1)NCC.I |
| InChI | InChI=1S/C23H34N6O.HI/c1-4-6-7-8-9-15-28(3)23(24-5-2)25-18-20-12-10-13-21(17-20)27-22(30)19-29-16-11-14-26-29;/h4,10-14,16-17H,1,5-9,15,18-19H2,2-3H3,(H,24,25)(H,27,30);1H |
| InChIKey | NDORCMMLKLVJOZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|