C19H35F3N4 — CID 109483381
1-hept-6-enyl-1,2-dimethyl-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine (PubChem CID 109483381) has the molecular formula C19H35F3N4 and a molecular weight of 376.51 g/mol. Its IUPAC name is 1-hept-6-enyl-1,2-dimethyl-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine.
| Compound Name | 1-hept-6-enyl-1,2-dimethyl-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 109483381 |
| Molecular Formula | C19H35F3N4 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | 1-hept-6-enyl-1,2-dimethyl-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCCC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C19H35F3N4/c1-4-5-6-7-8-13-25(3)18(23-2)24-12-9-17-10-14-26(15-11-17)16-19(20,21)22/h4,17H,1,5-16H2,2-3H3,(H,23,24) |
| InChIKey | SRFMCCXZJMLFHK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|