C17H32F3IN4O2S — CID 109484186
1-hept-6-enyl-1,2-dimethyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 109484186) has the molecular formula C17H32F3IN4O2S and a molecular weight of 540.43 g/mol. Its IUPAC name is 1-hept-6-enyl-1,2-dimethyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-hept-6-enyl-1,2-dimethyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109484186 |
| Molecular Formula | C17H32F3IN4O2S |
| Molecular Weight | 540.43 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | 1-hept-6-enyl-1,2-dimethyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCC1CCN(S(=O)(=O)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C17H31F3N4O2S.HI/c1-4-5-6-7-8-11-23(3)16(21-2)22-14-15-9-12-24(13-10-15)27(25,26)17(18,19)20;/h4,15H,1,5-14H2,2-3H3,(H,21,22);1H |
| InChIKey | IKKTXNHVNBDAFW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|