C15H28F3IN4O2S — CID 109498733
1,2-dimethyl-1-pent-4-enyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 109498733) has the molecular formula C15H28F3IN4O2S and a molecular weight of 512.38 g/mol. Its IUPAC name is 1,2-dimethyl-1-pent-4-enyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-pent-4-enyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109498733 |
| Molecular Formula | C15H28F3IN4O2S |
| Molecular Weight | 512.38 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | 1,2-dimethyl-1-pent-4-enyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N\C)NCC1CCN(S(=O)(=O)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C15H27F3N4O2S.HI/c1-4-5-6-9-21(3)14(19-2)20-12-13-7-10-22(11-8-13)25(23,24)15(16,17)18;/h4,13H,1,5-12H2,2-3H3,(H,19,20);1H |
| InChIKey | NKXFEAIXTHIHIB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|