C18H33F3N4O2S — CID 109483333
3-ethyl-1-hept-6-enyl-1-methyl-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine (PubChem CID 109483333) has the molecular formula C18H33F3N4O2S and a molecular weight of 426.55 g/mol. Its IUPAC name is 3-ethyl-1-hept-6-enyl-1-methyl-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 3-ethyl-1-hept-6-enyl-1-methyl-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 109483333 |
| Molecular Formula | C18H33F3N4O2S |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 3-ethyl-1-hept-6-enyl-1-methyl-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
| SMILES | C=CCCCCCN(C)/C(=N/CC1CCN(S(=O)(=O)C(F)(F)F)CC1)NCC |
| InChI | InChI=1S/C18H33F3N4O2S/c1-4-6-7-8-9-12-24(3)17(22-5-2)23-15-16-10-13-25(14-11-16)28(26,27)18(19,20)21/h4,16H,1,5-15H2,2-3H3,(H,22,23) |
| InChIKey | UUYGWWPJTHATIE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|