C17H31F3N4O2S — CID 109484187
1-hept-6-enyl-1,2-dimethyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine (PubChem CID 109484187) has the molecular formula C17H31F3N4O2S and a molecular weight of 412.52 g/mol. Its IUPAC name is 1-hept-6-enyl-1,2-dimethyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 1-hept-6-enyl-1,2-dimethyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 109484187 |
| Molecular Formula | C17H31F3N4O2S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 1-hept-6-enyl-1,2-dimethyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCC1CCN(S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H31F3N4O2S/c1-4-5-6-7-8-11-23(3)16(21-2)22-14-15-9-12-24(13-10-15)27(25,26)17(18,19)20/h4,15H,1,5-14H2,2-3H3,(H,21,22) |
| InChIKey | SYXJFEVXMMZNLP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|