C16H34IN3O2 — CID 109483630
3-ethyl-1-hept-6-enyl-2-[2-(2-methoxyethoxy)ethyl]-1-methylguanidine;hydroiodide (PubChem CID 109483630) has the molecular formula C16H34IN3O2 and a molecular weight of 427.37 g/mol. Its IUPAC name is 3-ethyl-1-hept-6-enyl-2-[2-(2-methoxyethoxy)ethyl]-1-methylguanidine;hydroiodide.
| Compound Name | 3-ethyl-1-hept-6-enyl-2-[2-(2-methoxyethoxy)ethyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109483630 |
| Molecular Formula | C16H34IN3O2 |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 3-ethyl-1-hept-6-enyl-2-[2-(2-methoxyethoxy)ethyl]-1-methylguanidine;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N\CCOCCOC)NCC.I |
| InChI | InChI=1S/C16H33N3O2.HI/c1-5-7-8-9-10-12-19(3)16(17-6-2)18-11-13-21-15-14-20-4;/h5H,1,6-15H2,2-4H3,(H,17,18);1H |
| InChIKey | HTNXKLQRJIQHEL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|