C20H32N4O3S2 — CID 109484808
2-ethyl-N'-methyl-N-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]thiomorpholine-4-carboximidamide (PubChem CID 109484808) has the molecular formula C20H32N4O3S2 and a molecular weight of 440.64 g/mol. Its IUPAC name is 2-ethyl-N'-methyl-N-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]thiomorpholine-4-carboximidamide.
| Compound Name | 2-ethyl-N'-methyl-N-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109484808 |
| Molecular Formula | C20H32N4O3S2 |
| Molecular Weight | 440.64 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 2-ethyl-N'-methyl-N-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]thiomorpholine-4-carboximidamide |
| SMILES | CCC1CN(/C(=N\C)NCc2ccc(S(=O)(=O)NCC3CCCO3)cc2)CCS1 |
| InChI | InChI=1S/C20H32N4O3S2/c1-3-18-15-24(10-12-28-18)20(21-2)22-13-16-6-8-19(9-7-16)29(25,26)23-14-17-5-4-11-27-17/h6-9,17-18,23H,3-5,10-15H2,1-2H3,(H,21,22) |
| InChIKey | JARRCMXWMSQKKZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.64 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|