C20H34O4Si — CID 10948557
(1'R,5'S,8'R,9'S)-9'-[tert-butyl(dimethyl)silyl]oxy-8'-methylspiro[1,3-dioxolane-2,4'-tricyclo[6.3.0.01,5]undecane]-6'-one (PubChem CID 10948557) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is (1'R,5'S,8'R,9'S)-9'-[tert-butyl(dimethyl)silyl]oxy-8'-methylspiro[1,3-dioxolane-2,4'-tricyclo[6.3.0.01,5]undecane]-6'-one.
| Compound Name | (1'R,5'S,8'R,9'S)-9'-[tert-butyl(dimethyl)silyl]oxy-8'-methylspiro[1,3-dioxolane-2,4'-tricyclo[6.3.0.01,5]undecane]-6'-one |
|---|---|
| PubChem CID | 10948557 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (1'R,5'S,8'R,9'S)-9'-[tert-butyl(dimethyl)silyl]oxy-8'-methylspiro[1,3-dioxolane-2,4'-tricyclo[6.3.0.01,5]undecane]-6'-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@@]23CCC4(OCCO4)[C@@H]2C(=O)C[C@@]13C |
| InChI | InChI=1S/C20H34O4Si/c1-17(2,3)25(5,6)24-15-7-8-19-9-10-20(22-11-12-23-20)16(19)14(21)13-18(15,19)4/h15-16H,7-13H2,1-6H3/t15-,16+,18-,19+/m0/s1 |
| InChIKey | FRSUPHCARJUYJW-OGWHTMIXSA-N |
| XLogP | 4.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|