C20H36O4Si — CID 560610
9-(2-methoxyethoxymethoxy)-4,8-dimethyl-6-trimethylsilyltricyclo[6.3.0.01,5]undecan-3-one (PubChem CID 560610) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is 9-(2-methoxyethoxymethoxy)-4,8-dimethyl-6-trimethylsilyltricyclo[6.3.0.01,5]undecan-3-one.
| Compound Name | 9-(2-methoxyethoxymethoxy)-4,8-dimethyl-6-trimethylsilyltricyclo[6.3.0.01,5]undecan-3-one |
|---|---|
| PubChem CID | 560610 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 9-(2-methoxyethoxymethoxy)-4,8-dimethyl-6-trimethylsilyltricyclo[6.3.0.01,5]undecan-3-one |
| SMILES | COCCOCOC1CCC23CC(=O)C(C)C2C([Si](C)(C)C)CC13C |
| InChI | InChI=1S/C20H36O4Si/c1-14-15(21)11-20-8-7-17(24-13-23-10-9-22-3)19(20,2)12-16(18(14)20)25(4,5)6/h14,16-18H,7-13H2,1-6H3 |
| InChIKey | JMHMDJLZJNVBQO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|