C18H30O4 — CID 11045130
(3R,3aS,3bS,6aR,7aR)-3-(2-methoxyethoxymethoxy)-3a,5,5-trimethyl-1,3,3b,4,6,6a,7,7a-octahydrocyclopenta[a]pentalen-2-one (PubChem CID 11045130) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is (3R,3aS,3bS,6aR,7aR)-3-(2-methoxyethoxymethoxy)-3a,5,5-trimethyl-1,3,3b,4,6,6a,7,7a-octahydrocyclopenta[a]pentalen-2-one.
| Compound Name | (3R,3aS,3bS,6aR,7aR)-3-(2-methoxyethoxymethoxy)-3a,5,5-trimethyl-1,3,3b,4,6,6a,7,7a-octahydrocyclopenta[a]pentalen-2-one |
|---|---|
| PubChem CID | 11045130 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (3R,3aS,3bS,6aR,7aR)-3-(2-methoxyethoxymethoxy)-3a,5,5-trimethyl-1,3,3b,4,6,6a,7,7a-octahydrocyclopenta[a]pentalen-2-one |
| SMILES | COCCOCO[C@H]1C(=O)C[C@H]2C[C@@H]3CC(C)(C)C[C@@H]3[C@]21C |
| InChI | InChI=1S/C18H30O4/c1-17(2)9-12-7-13-8-15(19)16(18(13,3)14(12)10-17)22-11-21-6-5-20-4/h12-14,16H,5-11H2,1-4H3/t12-,13-,14+,16+,18+/m1/s1 |
| InChIKey | ADQPBSAXUGYTKB-RIENRQNYSA-N |
| XLogP | 3.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|