C17H32O3Si — CID 134922322
(1S,3aR,6R,6aR)-1,5,5-trimethyl-6-(2-trimethylsilylethoxymethoxy)-1,3,3a,4,6,6a-hexahydropentalen-2-one (PubChem CID 134922322) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is (1S,3aR,6R,6aR)-1,5,5-trimethyl-6-(2-trimethylsilylethoxymethoxy)-1,3,3a,4,6,6a-hexahydropentalen-2-one.
| Compound Name | (1S,3aR,6R,6aR)-1,5,5-trimethyl-6-(2-trimethylsilylethoxymethoxy)-1,3,3a,4,6,6a-hexahydropentalen-2-one |
|---|---|
| PubChem CID | 134922322 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (1S,3aR,6R,6aR)-1,5,5-trimethyl-6-(2-trimethylsilylethoxymethoxy)-1,3,3a,4,6,6a-hexahydropentalen-2-one |
| SMILES | C[C@@H]1C(=O)C[C@H]2CC(C)(C)[C@H](OCOCC[Si](C)(C)C)[C@H]21 |
| InChI | InChI=1S/C17H32O3Si/c1-12-14(18)9-13-10-17(2,3)16(15(12)13)20-11-19-7-8-21(4,5)6/h12-13,15-16H,7-11H2,1-6H3/t12-,13+,15+,16-/m1/s1 |
| InChIKey | FOODUTFQOQONLN-BFJAYTPKSA-N |
| XLogP | 3.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|