C22H40O5Si — CID 162786779
(1S,3R,5S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-6,6-dimethyltricyclo[3.3.3.01,5]undecane-3-carboxylic acid (PubChem CID 162786779) has the molecular formula C22H40O5Si and a molecular weight of 412.64 g/mol. Its IUPAC name is (1S,3R,5S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-6,6-dimethyltricyclo[3.3.3.01,5]undecane-3-carboxylic acid.
| Compound Name | (1S,3R,5S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-6,6-dimethyltricyclo[3.3.3.01,5]undecane-3-carboxylic acid |
|---|---|
| PubChem CID | 162786779 |
| Molecular Formula | C22H40O5Si |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | (1S,3R,5S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-6,6-dimethyltricyclo[3.3.3.01,5]undecane-3-carboxylic acid |
| SMILES | COCOC1C[C@@]23C[C@H](C(=O)O)C[C@@]2(CC[C@H]3O[Si](C)(C)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C22H40O5Si/c1-19(2,3)28(7,8)27-16-9-10-22-12-15(18(23)24)11-21(16,22)13-17(20(22,4)5)26-14-25-6/h15-17H,9-14H2,1-8H3,(H,23,24)/t15-,16+,17?,21+,22-/m0/s1 |
| InChIKey | RDSYMWLRHUNQJP-FHYPBZLYSA-N |
| XLogP | 5.06 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|