C21H38O3Si — CID 162786866
(1R,3S,5R,9R)-7-[tert-butyl(dimethyl)silyl]oxy-6,6,9-trimethyltricyclo[3.3.3.01,5]undecane-3-carboxylic acid (PubChem CID 162786866) has the molecular formula C21H38O3Si and a molecular weight of 366.62 g/mol. Its IUPAC name is (1R,3S,5R,9R)-7-[tert-butyl(dimethyl)silyl]oxy-6,6,9-trimethyltricyclo[3.3.3.01,5]undecane-3-carboxylic acid.
| Compound Name | (1R,3S,5R,9R)-7-[tert-butyl(dimethyl)silyl]oxy-6,6,9-trimethyltricyclo[3.3.3.01,5]undecane-3-carboxylic acid |
|---|---|
| PubChem CID | 162786866 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | (1R,3S,5R,9R)-7-[tert-butyl(dimethyl)silyl]oxy-6,6,9-trimethyltricyclo[3.3.3.01,5]undecane-3-carboxylic acid |
| SMILES | C[C@@H]1CC[C@@]23C[C@@H](C(=O)O)C[C@@]12CC(O[Si](C)(C)C(C)(C)C)C3(C)C |
| InChI | InChI=1S/C21H38O3Si/c1-14-9-10-21-12-15(17(22)23)11-20(14,21)13-16(19(21,5)6)24-25(7,8)18(2,3)4/h14-16H,9-13H2,1-8H3,(H,22,23)/t14-,15+,16?,20-,21+/m1/s1 |
| InChIKey | DPLCVWVERNVDLD-CXYXYMCXSA-N |
| XLogP | 5.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|