C22H40O3Si — CID 11153220
methyl (1S,2S,5S,6S,8S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2,10,10-trimethyltricyclo[6.3.0.01,5]undecane-6-carboxylate (PubChem CID 11153220) has the molecular formula C22H40O3Si and a molecular weight of 380.65 g/mol. Its IUPAC name is methyl (1S,2S,5S,6S,8S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2,10,10-trimethyltricyclo[6.3.0.01,5]undecane-6-carboxylate.
| Compound Name | methyl (1S,2S,5S,6S,8S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2,10,10-trimethyltricyclo[6.3.0.01,5]undecane-6-carboxylate |
|---|---|
| PubChem CID | 11153220 |
| Molecular Formula | C22H40O3Si |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | methyl (1S,2S,5S,6S,8S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2,10,10-trimethyltricyclo[6.3.0.01,5]undecane-6-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C[C@@]23[C@@H](C)CC[C@@H]13 |
| InChI | InChI=1S/C22H40O3Si/c1-14-10-11-16-15(19(23)24-7)12-17-18(21(5,6)13-22(14,16)17)25-26(8,9)20(2,3)4/h14-18H,10-13H2,1-9H3/t14-,15-,16-,17+,18+,22-/m0/s1 |
| InChIKey | FYJTXCYHHNXBGF-XHOAPHRNSA-N |
| XLogP | 5.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|