C16H29N5S — CID 109486322
N,2-diethyl-N'-[3-(5-methyl-1H-pyrazol-4-yl)propyl]thiomorpholine-4-carboximidamide (PubChem CID 109486322) has the molecular formula C16H29N5S and a molecular weight of 323.51 g/mol. Its IUPAC name is N,2-diethyl-N'-[3-(5-methyl-1H-pyrazol-4-yl)propyl]thiomorpholine-4-carboximidamide.
| Compound Name | N,2-diethyl-N'-[3-(5-methyl-1H-pyrazol-4-yl)propyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109486322 |
| Molecular Formula | C16H29N5S |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | N,2-diethyl-N'-[3-(5-methyl-1H-pyrazol-4-yl)propyl]thiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\CCCc1cn[nH]c1C)N1CCSC(CC)C1 |
| InChI | InChI=1S/C16H29N5S/c1-4-15-12-21(9-10-22-15)16(17-5-2)18-8-6-7-14-11-19-20-13(14)3/h11,15H,4-10,12H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | ORNHWFPPTGVWNK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|