C19H28IN3S — CID 109486399
N-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-ylmethyl)-2-ethyl-N'-methylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109486399) has the molecular formula C19H28IN3S and a molecular weight of 457.43 g/mol. Its IUPAC name is N-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-ylmethyl)-2-ethyl-N'-methylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-ylmethyl)-2-ethyl-N'-methylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109486399 |
| Molecular Formula | C19H28IN3S |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | N-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-ylmethyl)-2-ethyl-N'-methylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCC1CN(/C(=N\C)NCC2C3Cc4ccccc4C23)CCS1.I |
| InChI | InChI=1S/C19H27N3S.HI/c1-3-14-12-22(8-9-23-14)19(20-2)21-11-17-16-10-13-6-4-5-7-15(13)18(16)17;/h4-7,14,16-18H,3,8-12H2,1-2H3,(H,20,21);1H |
| InChIKey | FAYFJGKBIGRDHK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|