C17H22ClN5OS — CID 109489459
N-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide (PubChem CID 109489459) has the molecular formula C17H22ClN5OS and a molecular weight of 379.92 g/mol. Its IUPAC name is N-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide.
| Compound Name | N-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109489459 |
| Molecular Formula | C17H22ClN5OS |
| Molecular Weight | 379.92 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | N-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide |
| SMILES | C/N=C(\NCc1nc(-c2ccc(Cl)cc2)no1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C17H22ClN5OS/c1-17(2)11-23(8-9-25-17)16(19-3)20-10-14-21-15(22-24-14)12-4-6-13(18)7-5-12/h4-7H,8-11H2,1-3H3,(H,19,20) |
| InChIKey | GICUBITWLJFJSW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.92 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|