C15H30FN3 — CID 109490708
N-ethyl-N'-(3-fluoropropyl)-3-methyl-3-propylpiperidine-1-carboximidamide (PubChem CID 109490708) has the molecular formula C15H30FN3 and a molecular weight of 271.42 g/mol. Its IUPAC name is N-ethyl-N'-(3-fluoropropyl)-3-methyl-3-propylpiperidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-(3-fluoropropyl)-3-methyl-3-propylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109490708 |
| Molecular Formula | C15H30FN3 |
| Molecular Weight | 271.42 g/mol |
| Exact Mass | 271.24 |
| IUPAC Name | N-ethyl-N'-(3-fluoropropyl)-3-methyl-3-propylpiperidine-1-carboximidamide |
| SMILES | CCCC1(C)CCCN(/C(=N/CCCF)NCC)C1 |
| InChI | InChI=1S/C15H30FN3/c1-4-8-15(3)9-6-12-19(13-15)14(17-5-2)18-11-7-10-16/h4-13H2,1-3H3,(H,17,18) |
| InChIKey | QMHVGMXRKCEZAJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|