C14H28FN3 — CID 109490928
N-(3-fluoropropyl)-N',3-dimethyl-3-propylpiperidine-1-carboximidamide (PubChem CID 109490928) has the molecular formula C14H28FN3 and a molecular weight of 257.40 g/mol. Its IUPAC name is N-(3-fluoropropyl)-N',3-dimethyl-3-propylpiperidine-1-carboximidamide.
| Compound Name | N-(3-fluoropropyl)-N',3-dimethyl-3-propylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109490928 |
| Molecular Formula | C14H28FN3 |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.23 |
| IUPAC Name | N-(3-fluoropropyl)-N',3-dimethyl-3-propylpiperidine-1-carboximidamide |
| SMILES | CCCC1(C)CCCN(/C(=N/C)NCCCF)C1 |
| InChI | InChI=1S/C14H28FN3/c1-4-7-14(2)8-5-11-18(12-14)13(16-3)17-10-6-9-15/h4-12H2,1-3H3,(H,16,17) |
| InChIKey | FTAUSRGRWCILLD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|