C23H24N2O2S — CID 10949227
7-(5,6-diphenylpyridazin-3-yl)sulfanylheptanoic acid (PubChem CID 10949227) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is 7-(5,6-diphenylpyridazin-3-yl)sulfanylheptanoic acid.
| Compound Name | 7-(5,6-diphenylpyridazin-3-yl)sulfanylheptanoic acid |
|---|---|
| PubChem CID | 10949227 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 7-(5,6-diphenylpyridazin-3-yl)sulfanylheptanoic acid |
| SMILES | O=C(O)CCCCCCSc1cc(-c2ccccc2)c(-c2ccccc2)nn1 |
| InChI | InChI=1S/C23H24N2O2S/c26-22(27)15-9-1-2-10-16-28-21-17-20(18-11-5-3-6-12-18)23(25-24-21)19-13-7-4-8-14-19/h3-8,11-14,17H,1-2,9-10,15-16H2,(H,26,27) |
| InChIKey | YIKUVKQQDOPHJY-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|