C25H28N2O3 — CID 10250660
9-(2-oxo-4,5-diphenylpyrimidin-1-yl)nonanoic acid (PubChem CID 10250660) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 9-(2-oxo-4,5-diphenylpyrimidin-1-yl)nonanoic acid.
| Compound Name | 9-(2-oxo-4,5-diphenylpyrimidin-1-yl)nonanoic acid |
|---|---|
| PubChem CID | 10250660 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 9-(2-oxo-4,5-diphenylpyrimidin-1-yl)nonanoic acid |
| SMILES | O=C(O)CCCCCCCCn1cc(-c2ccccc2)c(-c2ccccc2)nc1=O |
| InChI | InChI=1S/C25H28N2O3/c28-23(29)17-11-3-1-2-4-12-18-27-19-22(20-13-7-5-8-14-20)24(26-25(27)30)21-15-9-6-10-16-21/h5-10,13-16,19H,1-4,11-12,17-18H2,(H,28,29) |
| InChIKey | AQOVWACWKGWMMS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|