C25H26F3N3O4 — CID 68581358
7-[(4,5-diphenylpyrimidin-2-yl)amino]heptanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 68581358) has the molecular formula C25H26F3N3O4 and a molecular weight of 489.49 g/mol. Its IUPAC name is 7-[(4,5-diphenylpyrimidin-2-yl)amino]heptanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 7-[(4,5-diphenylpyrimidin-2-yl)amino]heptanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68581358 |
| Molecular Formula | C25H26F3N3O4 |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 7-[(4,5-diphenylpyrimidin-2-yl)amino]heptanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCCCCCNc1ncc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H25N3O2.C2HF3O2/c27-21(28)15-9-1-2-10-16-24-23-25-17-20(18-11-5-3-6-12-18)22(26-23)19-13-7-4-8-14-19;3-2(4,5)1(6)7/h3-8,11-14,17H,1-2,9-10,15-16H2,(H,27,28)(H,24,25,26);(H,6,7) |
| InChIKey | IHYCFWWRRQFGQB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|