C25H24F3N3O3 — CID 87504937
(2,2,2-trifluoroacetyl) 7-[(4,5-diphenylpyrimidin-2-yl)amino]heptanoate (PubChem CID 87504937) has the molecular formula C25H24F3N3O3 and a molecular weight of 471.48 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 7-[(4,5-diphenylpyrimidin-2-yl)amino]heptanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 7-[(4,5-diphenylpyrimidin-2-yl)amino]heptanoate |
|---|---|
| PubChem CID | 87504937 |
| Molecular Formula | C25H24F3N3O3 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 7-[(4,5-diphenylpyrimidin-2-yl)amino]heptanoate |
| SMILES | O=C(CCCCCCNc1ncc(-c2ccccc2)c(-c2ccccc2)n1)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C25H24F3N3O3/c26-25(27,28)23(33)34-21(32)15-9-1-2-10-16-29-24-30-17-20(18-11-5-3-6-12-18)22(31-24)19-13-7-4-8-14-19/h3-8,11-14,17H,1-2,9-10,15-16H2,(H,29,30,31) |
| InChIKey | OIBPCKAHTDCSJT-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|