C23H27N3O3 — CID 10949247
1-[2-[bis[(1R)-1-phenylethyl]amino]-1-methoxyethyl]pyrimidine-2,4-dione (PubChem CID 10949247) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 1-[2-[bis[(1R)-1-phenylethyl]amino]-1-methoxyethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-[bis[(1R)-1-phenylethyl]amino]-1-methoxyethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10949247 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 1-[2-[bis[(1R)-1-phenylethyl]amino]-1-methoxyethyl]pyrimidine-2,4-dione |
| SMILES | COC(CN([C@H](C)c1ccccc1)[C@H](C)c1ccccc1)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C23H27N3O3/c1-17(19-10-6-4-7-11-19)26(18(2)20-12-8-5-9-13-20)16-22(29-3)25-15-14-21(27)24-23(25)28/h4-15,17-18,22H,16H2,1-3H3,(H,24,27,28)/t17-,18-,22?/m1/s1 |
| InChIKey | HQFQQCMJHZJAGP-XWATYHNTSA-N |
| XLogP | 3.51 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |