C18H28F2IN3O2 — CID 109494818
2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-ethyl-3-(2-propylcyclopropyl)guanidine;hydroiodide (PubChem CID 109494818) has the molecular formula C18H28F2IN3O2 and a molecular weight of 483.34 g/mol. Its IUPAC name is 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-ethyl-3-(2-propylcyclopropyl)guanidine;hydroiodide.
| Compound Name | 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-ethyl-3-(2-propylcyclopropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109494818 |
| Molecular Formula | C18H28F2IN3O2 |
| Molecular Weight | 483.34 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-ethyl-3-(2-propylcyclopropyl)guanidine;hydroiodide |
| SMILES | CCCC1CC1N/C(=N/CC(O)c1ccc(OC(F)F)cc1)NCC.I |
| InChI | InChI=1S/C18H27F2N3O2.HI/c1-3-5-13-10-15(13)23-18(21-4-2)22-11-16(24)12-6-8-14(9-7-12)25-17(19)20;/h6-9,13,15-17,24H,3-5,10-11H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | GGOJQDJVDNGGBM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|