C13H27N3 — CID 109495987
1,2-dimethyl-1-pent-4-enyl-3-pentylguanidine (PubChem CID 109495987) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is 1,2-dimethyl-1-pent-4-enyl-3-pentylguanidine.
| Compound Name | 1,2-dimethyl-1-pent-4-enyl-3-pentylguanidine |
|---|---|
| PubChem CID | 109495987 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | 1,2-dimethyl-1-pent-4-enyl-3-pentylguanidine |
| SMILES | C=CCCCN(C)/C(=N/C)NCCCCC |
| InChI | InChI=1S/C13H27N3/c1-5-7-9-11-15-13(14-3)16(4)12-10-8-6-2/h6H,2,5,7-12H2,1,3-4H3,(H,14,15) |
| InChIKey | WZZJRSYFIFSMGM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|