C18H27N5 — CID 109496304
1,2-dimethyl-3-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1-pent-4-enylguanidine (PubChem CID 109496304) has the molecular formula C18H27N5 and a molecular weight of 313.45 g/mol. Its IUPAC name is 1,2-dimethyl-3-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1-pent-4-enylguanidine.
| Compound Name | 1,2-dimethyl-3-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109496304 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 1,2-dimethyl-3-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N\C)NCCc1cn2cccc(C)c2n1 |
| InChI | InChI=1S/C18H27N5/c1-5-6-7-12-22(4)18(19-3)20-11-10-16-14-23-13-8-9-15(2)17(23)21-16/h5,8-9,13-14H,1,6-7,10-12H2,2-4H3,(H,19,20) |
| InChIKey | VWJILTMIJNAXOB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 44.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|