C16H29IN4O — CID 109497405
3-[2-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide (PubChem CID 109497405) has the molecular formula C16H29IN4O and a molecular weight of 420.34 g/mol. Its IUPAC name is 3-[2-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide.
| Compound Name | 3-[2-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109497405 |
| Molecular Formula | C16H29IN4O |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 3-[2-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N\C)NCC(C)c1c(C)noc1C.I |
| InChI | InChI=1S/C16H28N4O.HI/c1-7-8-9-10-20(6)16(17-5)18-11-12(2)15-13(3)19-21-14(15)4;/h7,12H,1,8-11H2,2-6H3,(H,17,18);1H |
| InChIKey | QXQIOBGADXHFEF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|