C19H38N4 — CID 109499536
3-ethyl-1-methyl-1-pent-4-enyl-2-(5-piperidin-1-ylpentyl)guanidine (PubChem CID 109499536) has the molecular formula C19H38N4 and a molecular weight of 322.54 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-pent-4-enyl-2-(5-piperidin-1-ylpentyl)guanidine.
| Compound Name | 3-ethyl-1-methyl-1-pent-4-enyl-2-(5-piperidin-1-ylpentyl)guanidine |
|---|---|
| PubChem CID | 109499536 |
| Molecular Formula | C19H38N4 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.31 |
| IUPAC Name | 3-ethyl-1-methyl-1-pent-4-enyl-2-(5-piperidin-1-ylpentyl)guanidine |
| SMILES | C=CCCCN(C)/C(=N/CCCCCN1CCCCC1)NCC |
| InChI | InChI=1S/C19H38N4/c1-4-6-10-15-22(3)19(20-5-2)21-14-9-7-11-16-23-17-12-8-13-18-23/h4H,1,5-18H2,2-3H3,(H,20,21) |
| InChIKey | RLTXJHORBMPDHP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|