C13H25F3N4 — CID 109499586
1,2-dimethyl-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-pent-4-enylguanidine (PubChem CID 109499586) has the molecular formula C13H25F3N4 and a molecular weight of 294.37 g/mol. Its IUPAC name is 1,2-dimethyl-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-pent-4-enylguanidine.
| Compound Name | 1,2-dimethyl-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109499586 |
| Molecular Formula | C13H25F3N4 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 1,2-dimethyl-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N/C)NCCN(C)CC(F)(F)F |
| InChI | InChI=1S/C13H25F3N4/c1-5-6-7-9-20(4)12(17-2)18-8-10-19(3)11-13(14,15)16/h5H,1,6-11H2,2-4H3,(H,17,18) |
| InChIKey | TURHBAUYVNLDLI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|