C30H52O4Si — CID 10951251
3-[(2R,4R,5R)-5-[(E)-5-[(4-methoxyphenyl)methoxy]pent-2-en-2-yl]-4-methyloxolan-2-yl]propoxy-tri(propan-2-yl)silane (PubChem CID 10951251) has the molecular formula C30H52O4Si and a molecular weight of 504.83 g/mol. Its IUPAC name is 3-[(2R,4R,5R)-5-[(E)-5-[(4-methoxyphenyl)methoxy]pent-2-en-2-yl]-4-methyloxolan-2-yl]propoxy-tri(propan-2-yl)silane.
| Compound Name | 3-[(2R,4R,5R)-5-[(E)-5-[(4-methoxyphenyl)methoxy]pent-2-en-2-yl]-4-methyloxolan-2-yl]propoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10951251 |
| Molecular Formula | C30H52O4Si |
| Molecular Weight | 504.83 g/mol |
| Exact Mass | 504.36 |
| IUPAC Name | 3-[(2R,4R,5R)-5-[(E)-5-[(4-methoxyphenyl)methoxy]pent-2-en-2-yl]-4-methyloxolan-2-yl]propoxy-tri(propan-2-yl)silane |
| SMILES | COc1ccc(COCC/C=C(\C)[C@@H]2O[C@H](CCCO[Si](C(C)C)(C(C)C)C(C)C)C[C@H]2C)cc1 |
| InChI | InChI=1S/C30H52O4Si/c1-22(2)35(23(3)4,24(5)6)33-19-11-13-29-20-26(8)30(34-29)25(7)12-10-18-32-21-27-14-16-28(31-9)17-15-27/h12,14-17,22-24,26,29-30H,10-11,13,18-21H2,1-9H3/b25-12+/t26-,29-,30+/m1/s1 |
| InChIKey | JTPZXSXYONCRTF-PZJZVSHSSA-N |
| XLogP | 8.31 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.83 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|