C13H24O3 — CID 10955326
(3S,4R,5E)-3-[2-(methoxymethoxy)ethyl]nona-1,5-dien-4-ol (PubChem CID 10955326) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is (3S,4R,5E)-3-[2-(methoxymethoxy)ethyl]nona-1,5-dien-4-ol.
| Compound Name | (3S,4R,5E)-3-[2-(methoxymethoxy)ethyl]nona-1,5-dien-4-ol |
|---|---|
| PubChem CID | 10955326 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (3S,4R,5E)-3-[2-(methoxymethoxy)ethyl]nona-1,5-dien-4-ol |
| SMILES | C=C[C@H](CCOCOC)[C@H](O)/C=C/CCC |
| InChI | InChI=1S/C13H24O3/c1-4-6-7-8-13(14)12(5-2)9-10-16-11-15-3/h5,7-8,12-14H,2,4,6,9-11H2,1,3H3/b8-7+/t12-,13-/m1/s1 |
| InChIKey | GHGKTOVKROTJMK-WUOSCTTQSA-N |
| XLogP | 2.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|