C10H20O3 — CID 155294637
(E,7R)-7-(methoxymethoxy)oct-2-en-1-ol (PubChem CID 155294637) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is (E,7R)-7-(methoxymethoxy)oct-2-en-1-ol.
| Compound Name | (E,7R)-7-(methoxymethoxy)oct-2-en-1-ol |
|---|---|
| PubChem CID | 155294637 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | (E,7R)-7-(methoxymethoxy)oct-2-en-1-ol |
| SMILES | COCO[C@H](C)CCC/C=C/CO |
| InChI | InChI=1S/C10H20O3/c1-10(13-9-12-2)7-5-3-4-6-8-11/h4,6,10-11H,3,5,7-9H2,1-2H3/b6-4+/t10-/m1/s1 |
| InChIKey | GGQZGQLZRDHXEZ-DFVUYQKZSA-N |
| XLogP | 1.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|