C13H15NO3 — CID 10955462
(6S)-6-methyl-4-[(1S)-1-phenylethyl]morpholine-2,5-dione (PubChem CID 10955462) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is (6S)-6-methyl-4-[(1S)-1-phenylethyl]morpholine-2,5-dione.
| Compound Name | (6S)-6-methyl-4-[(1S)-1-phenylethyl]morpholine-2,5-dione |
|---|---|
| PubChem CID | 10955462 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (6S)-6-methyl-4-[(1S)-1-phenylethyl]morpholine-2,5-dione |
| SMILES | C[C@@H]1OC(=O)CN([C@@H](C)c2ccccc2)C1=O |
| InChI | InChI=1S/C13H15NO3/c1-9(11-6-4-3-5-7-11)14-8-12(15)17-10(2)13(14)16/h3-7,9-10H,8H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | CPLRCYRMTVRFAP-UWVGGRQHSA-N |
| XLogP | 1.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |