C12H18O5 — CID 10955727
(1R,2R,6R,7S,10S)-2,4,4,7,10-pentamethyl-3,5,8,11-tetraoxatricyclo[5.3.1.02,6]undecan-9-one (PubChem CID 10955727) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is (1R,2R,6R,7S,10S)-2,4,4,7,10-pentamethyl-3,5,8,11-tetraoxatricyclo[5.3.1.02,6]undecan-9-one.
| Compound Name | (1R,2R,6R,7S,10S)-2,4,4,7,10-pentamethyl-3,5,8,11-tetraoxatricyclo[5.3.1.02,6]undecan-9-one |
|---|---|
| PubChem CID | 10955727 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (1R,2R,6R,7S,10S)-2,4,4,7,10-pentamethyl-3,5,8,11-tetraoxatricyclo[5.3.1.02,6]undecan-9-one |
| SMILES | C[C@@H]1C(=O)O[C@]2(C)O[C@H]1[C@@]1(C)OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C12H18O5/c1-6-7-11(4)9(16-10(2,3)17-11)12(5,14-7)15-8(6)13/h6-7,9H,1-5H3/t6-,7+,9+,11+,12-/m0/s1 |
| InChIKey | BCRYQXDXSLLXFH-YKHQUGAISA-N |
| XLogP | 1.20 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |