C13H19N5O2 — CID 10956797
9-[2-(2,2-dimethyl-1,3-dioxan-5-yl)ethyl]purin-2-amine (PubChem CID 10956797) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is 9-[2-(2,2-dimethyl-1,3-dioxan-5-yl)ethyl]purin-2-amine.
| Compound Name | 9-[2-(2,2-dimethyl-1,3-dioxan-5-yl)ethyl]purin-2-amine |
|---|---|
| PubChem CID | 10956797 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 9-[2-(2,2-dimethyl-1,3-dioxan-5-yl)ethyl]purin-2-amine |
| SMILES | CC1(C)OCC(CCn2cnc3cnc(N)nc32)CO1 |
| InChI | InChI=1S/C13H19N5O2/c1-13(2)19-6-9(7-20-13)3-4-18-8-16-10-5-15-12(14)17-11(10)18/h5,8-9H,3-4,6-7H2,1-2H3,(H2,14,15,17) |
| InChIKey | JAGXUSFVFJWYHH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |