C10H16N5O5P — CID 14541169
[4-(2-aminopurin-9-yl)-2-(hydroxymethyl)butyl] dihydrogen phosphate (PubChem CID 14541169) has the molecular formula C10H16N5O5P and a molecular weight of 317.24 g/mol. Its IUPAC name is [4-(2-aminopurin-9-yl)-2-(hydroxymethyl)butyl] dihydrogen phosphate.
| Compound Name | [4-(2-aminopurin-9-yl)-2-(hydroxymethyl)butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 14541169 |
| Molecular Formula | C10H16N5O5P |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | [4-(2-aminopurin-9-yl)-2-(hydroxymethyl)butyl] dihydrogen phosphate |
| SMILES | Nc1ncc2ncn(CCC(CO)COP(=O)(O)O)c2n1 |
| InChI | InChI=1S/C10H16N5O5P/c11-10-12-3-8-9(14-10)15(6-13-8)2-1-7(4-16)5-20-21(17,18)19/h3,6-7,16H,1-2,4-5H2,(H2,11,12,14)(H2,17,18,19) |
| InChIKey | XNTUFRBHKUXOBA-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 156.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|