C10H14N5O4P — CID 14541170
9-[2-(2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl)ethyl]purin-2-amine (PubChem CID 14541170) has the molecular formula C10H14N5O4P and a molecular weight of 299.23 g/mol. Its IUPAC name is 9-[2-(2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl)ethyl]purin-2-amine.
| Compound Name | 9-[2-(2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl)ethyl]purin-2-amine |
|---|---|
| PubChem CID | 14541170 |
| Molecular Formula | C10H14N5O4P |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 9-[2-(2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl)ethyl]purin-2-amine |
| SMILES | Nc1ncc2ncn(CCC3COP(=O)(O)OC3)c2n1 |
| InChI | InChI=1S/C10H14N5O4P/c11-10-12-3-8-9(14-10)15(6-13-8)2-1-7-4-18-20(16,17)19-5-7/h3,6-7H,1-2,4-5H2,(H,16,17)(H2,11,12,14) |
| InChIKey | VFDHNXZDDAVTQW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|