C14H27NO5Si — CID 10958100
ethyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-oxopyrrolidine-1-carboxylate (PubChem CID 10958100) has the molecular formula C14H27NO5Si and a molecular weight of 317.46 g/mol. Its IUPAC name is ethyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-oxopyrrolidine-1-carboxylate.
| Compound Name | ethyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10958100 |
| Molecular Formula | C14H27NO5Si |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | ethyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-oxopyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)N1C(=O)C[C@H](O)[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H27NO5Si/c1-7-19-13(18)15-10(11(16)8-12(15)17)9-20-21(5,6)14(2,3)4/h10-11,16H,7-9H2,1-6H3/t10-,11-/m0/s1 |
| InChIKey | OKPIMGCDKFQMNU-QWRGUYRKSA-N |
| XLogP | 2.13 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|