C15H29NO6Si — CID 46934909
tert-butyl (3R,4R,5S)-3,4-dihydroxy-2-oxo-5-(2-trimethylsilyloxypropan-2-yl)pyrrolidine-1-carboxylate (PubChem CID 46934909) has the molecular formula C15H29NO6Si and a molecular weight of 347.48 g/mol. Its IUPAC name is tert-butyl (3R,4R,5S)-3,4-dihydroxy-2-oxo-5-(2-trimethylsilyloxypropan-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R,5S)-3,4-dihydroxy-2-oxo-5-(2-trimethylsilyloxypropan-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 46934909 |
| Molecular Formula | C15H29NO6Si |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | tert-butyl (3R,4R,5S)-3,4-dihydroxy-2-oxo-5-(2-trimethylsilyloxypropan-2-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@H](O)[C@H](O)[C@H]1C(C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H29NO6Si/c1-14(2,3)21-13(20)16-11(9(17)10(18)12(16)19)15(4,5)22-23(6,7)8/h9-11,17-18H,1-8H3/t9-,10+,11-/m0/s1 |
| InChIKey | PQPDGAUUHDFDPI-AXFHLTTASA-N |
| XLogP | 1.48 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|