C18H35NO5Si — CID 11462948
(4S)-3-[(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyhexanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 11462948) has the molecular formula C18H35NO5Si and a molecular weight of 373.57 g/mol. Its IUPAC name is (4S)-3-[(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyhexanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyhexanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11462948 |
| Molecular Formula | C18H35NO5Si |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | (4S)-3-[(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyhexanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@H]1COC(=O)N1C(=O)C[C@H](O)C[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H35NO5Si/c1-12(2)15-11-23-17(22)19(15)16(21)10-14(20)9-13(3)24-25(7,8)18(4,5)6/h12-15,20H,9-11H2,1-8H3/t13-,14-,15-/m1/s1 |
| InChIKey | UJFOLHVASAKCOE-RBSFLKMASA-N |
| XLogP | 3.54 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|