C24H49NO5Si2 — CID 11225541
(4S)-3-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hexanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 11225541) has the molecular formula C24H49NO5Si2 and a molecular weight of 487.83 g/mol. Its IUPAC name is (4S)-3-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hexanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hexanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11225541 |
| Molecular Formula | C24H49NO5Si2 |
| Molecular Weight | 487.83 g/mol |
| Exact Mass | 487.31 |
| IUPAC Name | (4S)-3-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hexanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@H]1COC(=O)N1C(=O)C[C@@H](C[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H49NO5Si2/c1-17(2)20-16-28-22(27)25(20)21(26)15-19(30-32(12,13)24(7,8)9)14-18(3)29-31(10,11)23(4,5)6/h17-20H,14-16H2,1-13H3/t18-,19-,20-/m1/s1 |
| InChIKey | JXWITVVHVZJELF-VAMGGRTRSA-N |
| XLogP | 6.57 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.83 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|