C16H31NO5Si — CID 10521466
tert-butyl (2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-oxopyrrolidine-1-carboxylate (PubChem CID 10521466) has the molecular formula C16H31NO5Si and a molecular weight of 345.51 g/mol. Its IUPAC name is tert-butyl (2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10521466 |
| Molecular Formula | C16H31NO5Si |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | tert-butyl (2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C[C@H](O)[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H31NO5Si/c1-15(2,3)22-14(20)17-11(12(18)9-13(17)19)10-21-23(7,8)16(4,5)6/h11-12,18H,9-10H2,1-8H3/t11-,12+/m1/s1 |
| InChIKey | YVJIPASVYCPFCF-NEPJUHHUSA-N |
| XLogP | 2.91 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|