C16H22F2O3S — CID 10958527
ethyl 3-(benzenesulfinyl)-2,2-difluorooctanoate (PubChem CID 10958527) has the molecular formula C16H22F2O3S and a molecular weight of 332.41 g/mol. Its IUPAC name is ethyl 3-(benzenesulfinyl)-2,2-difluorooctanoate.
| Compound Name | ethyl 3-(benzenesulfinyl)-2,2-difluorooctanoate |
|---|---|
| PubChem CID | 10958527 |
| Molecular Formula | C16H22F2O3S |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | ethyl 3-(benzenesulfinyl)-2,2-difluorooctanoate |
| SMILES | CCCCCC(S(=O)c1ccccc1)C(F)(F)C(=O)OCC |
| InChI | InChI=1S/C16H22F2O3S/c1-3-5-7-12-14(16(17,18)15(19)21-4-2)22(20)13-10-8-6-9-11-13/h6,8-11,14H,3-5,7,12H2,1-2H3 |
| InChIKey | ASFGLQJRJFXRMM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|