C17H30O6Si — CID 10959296
methyl (Z,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5S)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enoate (PubChem CID 10959296) has the molecular formula C17H30O6Si and a molecular weight of 358.51 g/mol. Its IUPAC name is methyl (Z,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5S)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enoate.
| Compound Name | methyl (Z,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5S)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enoate |
|---|---|
| PubChem CID | 10959296 |
| Molecular Formula | C17H30O6Si |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | methyl (Z,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5S)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enoate |
| SMILES | COC(=O)/C=C\[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@@H]1C=O |
| InChI | InChI=1S/C17H30O6Si/c1-16(2,3)24(7,8)23-12(9-10-14(19)20-6)15-13(11-18)21-17(4,5)22-15/h9-13,15H,1-8H3/b10-9-/t12-,13-,15+/m1/s1 |
| InChIKey | SCSZBSWVDVPPIA-PQMBVFIOSA-N |
| XLogP | 2.83 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|